C19H35N3 — CID 11034097
(1R,4S,6R,10S)-10-methyl-6-nonyl-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene (PubChem CID 11034097) has the molecular formula C19H35N3 and a molecular weight of 305.51 g/mol. Its IUPAC name is (1R,4S,6R,10S)-10-methyl-6-nonyl-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene.
| Compound Name | (1R,4S,6R,10S)-10-methyl-6-nonyl-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene |
|---|---|
| PubChem CID | 11034097 |
| Molecular Formula | C19H35N3 |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.28 |
| IUPAC Name | (1R,4S,6R,10S)-10-methyl-6-nonyl-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene |
| SMILES | CCCCCCCCC[C@@H]1C[C@@H]2CC[C@@H]3C[C@H](C)NC(=N1)N32 |
| InChI | InChI=1S/C19H35N3/c1-3-4-5-6-7-8-9-10-16-14-18-12-11-17-13-15(2)20-19(21-16)22(17)18/h15-18H,3-14H2,1-2H3,(H,20,21)/t15-,16+,17+,18-/m0/s1 |
| InChIKey | JDTPCMYRORPQFP-MLHJIOFPSA-N |
| XLogP | 4.47 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|