C25H44OSi — CID 71600877
tert-butyl-dimethyl-[2-methylidene-4-(4-octylphenyl)butoxy]silane (PubChem CID 71600877) has the molecular formula C25H44OSi and a molecular weight of 388.71 g/mol. Its IUPAC name is tert-butyl-dimethyl-[2-methylidene-4-(4-octylphenyl)butoxy]silane.
| Compound Name | tert-butyl-dimethyl-[2-methylidene-4-(4-octylphenyl)butoxy]silane |
|---|---|
| PubChem CID | 71600877 |
| Molecular Formula | C25H44OSi |
| Molecular Weight | 388.71 g/mol |
| Exact Mass | 388.32 |
| IUPAC Name | tert-butyl-dimethyl-[2-methylidene-4-(4-octylphenyl)butoxy]silane |
| SMILES | C=C(CCc1ccc(CCCCCCCC)cc1)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H44OSi/c1-8-9-10-11-12-13-14-23-17-19-24(20-18-23)16-15-22(2)21-26-27(6,7)25(3,4)5/h17-20H,2,8-16,21H2,1,3-7H3 |
| InChIKey | FALATJNHOUNHJM-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.71 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|