C21H22O5 — CID 71601578
dimethyl (1R,2S,3S,4R)-2-phenacylspiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxylate (PubChem CID 71601578) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is dimethyl (1R,2S,3S,4R)-2-phenacylspiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxylate.
| Compound Name | dimethyl (1R,2S,3S,4R)-2-phenacylspiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxylate |
|---|---|
| PubChem CID | 71601578 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | dimethyl (1R,2S,3S,4R)-2-phenacylspiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxylate |
| SMILES | COC(=O)[C@H]1[C@H]2C=C[C@H](C23CC3)[C@]1(CC(=O)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C21H22O5/c1-25-18(23)17-14-8-9-16(20(14)10-11-20)21(17,19(24)26-2)12-15(22)13-6-4-3-5-7-13/h3-9,14,16-17H,10-12H2,1-2H3/t14-,16-,17-,21+/m1/s1 |
| InChIKey | GPFUOYLDUFADEE-OILHZVAOSA-N |
| XLogP | 2.80 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|