C16H21N3O2S — CID 71609835
ethyl 4-[2-(methylamino)ethylamino]-2-(4-methylphenyl)-1,3-thiazole-5-carboxylate (PubChem CID 71609835) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is ethyl 4-[2-(methylamino)ethylamino]-2-(4-methylphenyl)-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 4-[2-(methylamino)ethylamino]-2-(4-methylphenyl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 71609835 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | ethyl 4-[2-(methylamino)ethylamino]-2-(4-methylphenyl)-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(-c2ccc(C)cc2)nc1NCCNC |
| InChI | InChI=1S/C16H21N3O2S/c1-4-21-16(20)13-14(18-10-9-17-3)19-15(22-13)12-7-5-11(2)6-8-12/h5-8,17-18H,4,9-10H2,1-3H3 |
| InChIKey | WRTHLFGZMSTFER-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|