C12H10FNO4 — CID 71609956
ethyl 2-(3-fluorophenyl)-4-oxo-1,3-oxazole-5-carboxylate (PubChem CID 71609956) has the molecular formula C12H10FNO4 and a molecular weight of 251.21 g/mol. Its IUPAC name is ethyl 2-(3-fluorophenyl)-4-oxo-1,3-oxazole-5-carboxylate.
| Compound Name | ethyl 2-(3-fluorophenyl)-4-oxo-1,3-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 71609956 |
| Molecular Formula | C12H10FNO4 |
| Molecular Weight | 251.21 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | ethyl 2-(3-fluorophenyl)-4-oxo-1,3-oxazole-5-carboxylate |
| SMILES | CCOC(=O)C1OC(c2cccc(F)c2)=NC1=O |
| InChI | InChI=1S/C12H10FNO4/c1-2-17-12(16)9-10(15)14-11(18-9)7-4-3-5-8(13)6-7/h3-6,9H,2H2,1H3 |
| InChIKey | QJRVSKWHAVIMSG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|