C14H13F3N3O6S- — CID 7161054
2-[(4R,5S,6R)-5-ethoxycarbonyl-6-hydroxy-2-sulfanylidene-6-(trifluoromethyl)-1,3-diazinan-4-yl]-4-nitrophenolate (PubChem CID 7161054) has the molecular formula C14H13F3N3O6S- and a molecular weight of 408.33 g/mol. Its IUPAC name is 2-[(4R,5S,6R)-5-ethoxycarbonyl-6-hydroxy-2-sulfanylidene-6-(trifluoromethyl)-1,3-diazinan-4-yl]-4-nitrophenolate.
| Compound Name | 2-[(4R,5S,6R)-5-ethoxycarbonyl-6-hydroxy-2-sulfanylidene-6-(trifluoromethyl)-1,3-diazinan-4-yl]-4-nitrophenolate |
|---|---|
| PubChem CID | 7161054 |
| Molecular Formula | C14H13F3N3O6S- |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 2-[(4R,5S,6R)-5-ethoxycarbonyl-6-hydroxy-2-sulfanylidene-6-(trifluoromethyl)-1,3-diazinan-4-yl]-4-nitrophenolate |
| SMILES | CCOC(=O)[C@H]1C(c2cc([N+](=O)[O-])ccc2[O-])NC(=S)N[C@]1(O)C(F)(F)F |
| InChI | InChI=1S/C14H14F3N3O6S/c1-2-26-11(22)9-10(7-5-6(20(24)25)3-4-8(7)21)18-12(27)19-13(9,23)14(15,16)17/h3-5,9-10,21,23H,2H2,1H3,(H2,18,19,27)/p-1/t9-,10?,13-/m1/s1 |
| InChIKey | HFPVHFKMWIGMJN-NDAPUWOLSA-M |
| XLogP | 0.62 |
| TPSA | 136.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|