C21H14FN5 — CID 71612330
6-(3-fluorophenyl)-N-(1H-indazol-4-yl)quinazolin-4-amine (PubChem CID 71612330) has the molecular formula C21H14FN5 and a molecular weight of 355.38 g/mol. Its IUPAC name is 6-(3-fluorophenyl)-N-(1H-indazol-4-yl)quinazolin-4-amine.
| Compound Name | 6-(3-fluorophenyl)-N-(1H-indazol-4-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 71612330 |
| Molecular Formula | C21H14FN5 |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 6-(3-fluorophenyl)-N-(1H-indazol-4-yl)quinazolin-4-amine |
| SMILES | Fc1cccc(-c2ccc3ncnc(Nc4cccc5[nH]ncc45)c3c2)c1 |
| InChI | InChI=1S/C21H14FN5/c22-15-4-1-3-13(9-15)14-7-8-18-16(10-14)21(24-12-23-18)26-19-5-2-6-20-17(19)11-25-27-20/h1-12H,(H,25,27)(H,23,24,26) |
| InChIKey | NRQIJWIEEFFCNG-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |