C23H20FIN4 — CID 170263023
6-[6-ethyl-5-(iodomethyl)-3-pyridinyl]-N-(2-fluoro-3-methylphenyl)quinazolin-4-amine (PubChem CID 170263023) has the molecular formula C23H20FIN4 and a molecular weight of 498.34 g/mol. Its IUPAC name is 6-[6-ethyl-5-(iodomethyl)-3-pyridinyl]-N-(2-fluoro-3-methylphenyl)quinazolin-4-amine.
| Compound Name | 6-[6-ethyl-5-(iodomethyl)-3-pyridinyl]-N-(2-fluoro-3-methylphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 170263023 |
| Molecular Formula | C23H20FIN4 |
| Molecular Weight | 498.34 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | 6-[6-ethyl-5-(iodomethyl)-3-pyridinyl]-N-(2-fluoro-3-methylphenyl)quinazolin-4-amine |
| SMILES | CCc1ncc(-c2ccc3ncnc(Nc4cccc(C)c4F)c3c2)cc1CI |
| InChI | InChI=1S/C23H20FIN4/c1-3-19-16(11-25)9-17(12-26-19)15-7-8-20-18(10-15)23(28-13-27-20)29-21-6-4-5-14(2)22(21)24/h4-10,12-13H,3,11H2,1-2H3,(H,27,28,29) |
| InChIKey | NWTZMIXMBQIOAV-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.34 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|