C30H31FO8S — CID 71613094
2-[(3S,8S)-3-[3-[3-fluoro-2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]-2,3,7,8-tetrahydrofuro[2,3-g][1,4]benzodioxin-8-yl]acetic acid (PubChem CID 71613094) has the molecular formula C30H31FO8S and a molecular weight of 570.64 g/mol. Its IUPAC name is 2-[(3S,8S)-3-[3-[3-fluoro-2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]-2,3,7,8-tetrahydrofuro[2,3-g][1,4]benzodioxin-8-yl]acetic acid.
| Compound Name | 2-[(3S,8S)-3-[3-[3-fluoro-2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]-2,3,7,8-tetrahydrofuro[2,3-g][1,4]benzodioxin-8-yl]acetic acid |
|---|---|
| PubChem CID | 71613094 |
| Molecular Formula | C30H31FO8S |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.17 |
| IUPAC Name | 2-[(3S,8S)-3-[3-[3-fluoro-2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]-2,3,7,8-tetrahydrofuro[2,3-g][1,4]benzodioxin-8-yl]acetic acid |
| SMILES | Cc1cc(OCCCS(C)(=O)=O)c(F)c(C)c1-c1cccc([C@H]2COc3cc4c(cc3O2)OC[C@H]4CC(=O)O)c1 |
| InChI | InChI=1S/C30H31FO8S/c1-17-10-26(36-8-5-9-40(3,34)35)30(31)18(2)29(17)20-7-4-6-19(11-20)27-16-38-24-13-22-21(12-28(32)33)15-37-23(22)14-25(24)39-27/h4,6-7,10-11,13-14,21,27H,5,8-9,12,15-16H2,1-3H3,(H,32,33)/t21-,27-/m1/s1 |
| InChIKey | WVVQSZOLICVIIK-JIPXPUAJSA-N |
| XLogP | 5.39 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|