About 1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-4-piperidin-1-ium-1-ylpiperidine-4-carboxamide
1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-4-piperidin-1-ium-1-ylpiperidine-4-carboxamide (PubChem CID 7161881) has the molecular formula C21H29N4O2S+
and a molecular weight of 401.56 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-4-piperidin-1-ium-1-ylpiperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-4-piperidin-1-ium-1-ylpiperidine-4-carboxamide |
| PubChem CID | 7161881 |
| Molecular Formula | C21H29N4O2S+ |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-4-piperidin-1-ium-1-ylpiperidine-4-carboxamide |
| SMILES | COc1ccc(-c2csc(N3CCC(C(N)=O)([NH+]4CCCCC4)CC3)n2)cc1 |
| InChI | InChI=1S/C21H28N4O2S/c1-27-17-7-5-16(6-8-17)18-15-28-20(23-18)24-13-9-21(10-14-24,19(22)26)25-11-3-2-4-12-25/h5-8,15H,2-4,9-14H2,1H3,(H2,22,26)/p+1 |
| InChIKey | COYZMNJFOMDCAR-UHFFFAOYSA-O |
| XLogP | 1.71 |
| TPSA | 72.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-4-piperidin-1-ium-1-ylpiperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-4-piperidin-1-ium-1-ylpiperidine-4-carboxamide?
The IUPAC name of 1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-4-piperidin-1-ium-1-ylpiperidine-4-carboxamide (CID 7161881) is 1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-4-piperidin-1-ium-1-ylpiperidine-4-carboxamide.
What is the SMILES notation for 1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-4-piperidin-1-ium-1-ylpiperidine-4-carboxamide?
The canonical SMILES for 1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-4-piperidin-1-ium-1-ylpiperidine-4-carboxamide is COc1ccc(-c2csc(N3CCC(C(N)=O)([NH+]4CCCCC4)CC3)n2)cc1.
What is the InChIKey of 1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-4-piperidin-1-ium-1-ylpiperidine-4-carboxamide?
The InChIKey is COYZMNJFOMDCAR-UHFFFAOYSA-O. The full InChI is InChI=1S/C21H28N4O2S/c1-27-17-7-5-16(6-8-17)18-15-28-20(23-18)24-13-9-21(10-14-24,19(22)26)25-11-3-2-4-12-25/h5-8,15H,2-4,9-14H2,1H3,(H2,22,26)/p+1.
What are the key properties of 1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-4-piperidin-1-ium-1-ylpiperidine-4-carboxamide?
1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-4-piperidin-1-ium-1-ylpiperidine-4-carboxamide has a molecular weight of 401.56 g/mol, XLogP of 1.71, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-4-piperidin-1-ium-1-ylpiperidine-4-carboxamide is sourced from PubChem (CID 7161881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).