C8H14O3S — CID 71625240
(3aR,5R,6aS)-2,2,3a-trimethyl-6,6a-dihydro-4H-thieno[3,4-d][1,3]dioxole 5-oxide (PubChem CID 71625240) has the molecular formula C8H14O3S and a molecular weight of 190.26 g/mol. Its IUPAC name is (3aR,5R,6aS)-2,2,3a-trimethyl-6,6a-dihydro-4H-thieno[3,4-d][1,3]dioxole 5-oxide.
| Compound Name | (3aR,5R,6aS)-2,2,3a-trimethyl-6,6a-dihydro-4H-thieno[3,4-d][1,3]dioxole 5-oxide |
|---|---|
| PubChem CID | 71625240 |
| Molecular Formula | C8H14O3S |
| Molecular Weight | 190.26 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | (3aR,5R,6aS)-2,2,3a-trimethyl-6,6a-dihydro-4H-thieno[3,4-d][1,3]dioxole 5-oxide |
| SMILES | CC1(C)O[C@@H]2C[S@@](=O)C[C@]2(C)O1 |
| InChI | InChI=1S/C8H14O3S/c1-7(2)10-6-4-12(9)5-8(6,3)11-7/h6H,4-5H2,1-3H3/t6-,8+,12-/m1/s1 |
| InChIKey | QQLYMCONJFYGEH-UTMSNSNXSA-N |
| XLogP | 0.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.26 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |