C10H16ClNOS — CID 71637903
(3S)-3-(1-thiophen-2-ylethoxy)pyrrolidine;hydrochloride (PubChem CID 71637903) has the molecular formula C10H16ClNOS and a molecular weight of 233.76 g/mol. Its IUPAC name is (3S)-3-(1-thiophen-2-ylethoxy)pyrrolidine;hydrochloride.
| Compound Name | (3S)-3-(1-thiophen-2-ylethoxy)pyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 71637903 |
| Molecular Formula | C10H16ClNOS |
| Molecular Weight | 233.76 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | (3S)-3-(1-thiophen-2-ylethoxy)pyrrolidine;hydrochloride |
| SMILES | CC(O[C@H]1CCNC1)c1cccs1.Cl |
| InChI | InChI=1S/C10H15NOS.ClH/c1-8(10-3-2-6-13-10)12-9-4-5-11-7-9;/h2-3,6,8-9,11H,4-5,7H2,1H3;1H/t8?,9-;/m0./s1 |
| InChIKey | UNEKPXNXTDDUNP-MTFPJWTKSA-N |
| XLogP | 2.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.76 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |