C10H15Cl2N3O2S — CID 71639579
1-[(3-chloro-2-pyridinyl)sulfonyl]-2-methylpiperazine;hydrochloride (PubChem CID 71639579) has the molecular formula C10H15Cl2N3O2S and a molecular weight of 312.22 g/mol. Its IUPAC name is 1-[(3-chloro-2-pyridinyl)sulfonyl]-2-methylpiperazine;hydrochloride.
| Compound Name | 1-[(3-chloro-2-pyridinyl)sulfonyl]-2-methylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 71639579 |
| Molecular Formula | C10H15Cl2N3O2S |
| Molecular Weight | 312.22 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 1-[(3-chloro-2-pyridinyl)sulfonyl]-2-methylpiperazine;hydrochloride |
| SMILES | CC1CNCCN1S(=O)(=O)c1ncccc1Cl.Cl |
| InChI | InChI=1S/C10H14ClN3O2S.ClH/c1-8-7-12-5-6-14(8)17(15,16)10-9(11)3-2-4-13-10;/h2-4,8,12H,5-7H2,1H3;1H |
| InChIKey | AETNOTCTMYAFRE-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |