C10H14ClN3O2S — CID 97163398
(2S)-1-[(3-chloro-2-pyridinyl)sulfonyl]-2-methylpiperazine (PubChem CID 97163398) has the molecular formula C10H14ClN3O2S and a molecular weight of 275.76 g/mol. Its IUPAC name is (2S)-1-[(3-chloro-2-pyridinyl)sulfonyl]-2-methylpiperazine.
| Compound Name | (2S)-1-[(3-chloro-2-pyridinyl)sulfonyl]-2-methylpiperazine |
|---|---|
| PubChem CID | 97163398 |
| Molecular Formula | C10H14ClN3O2S |
| Molecular Weight | 275.76 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | (2S)-1-[(3-chloro-2-pyridinyl)sulfonyl]-2-methylpiperazine |
| SMILES | C[C@H]1CNCCN1S(=O)(=O)c1ncccc1Cl |
| InChI | InChI=1S/C10H14ClN3O2S/c1-8-7-12-5-6-14(8)17(15,16)10-9(11)3-2-4-13-10/h2-4,8,12H,5-7H2,1H3/t8-/m0/s1 |
| InChIKey | QUESGKWOEGRXOY-QMMMGPOBSA-N |
| XLogP | 0.72 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.76 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |