C9H16N4O2S — CID 104710234
2-methyl-1-(2-methylpyrazol-3-yl)sulfonylpiperazine (PubChem CID 104710234) has the molecular formula C9H16N4O2S and a molecular weight of 244.32 g/mol. Its IUPAC name is 2-methyl-1-(2-methylpyrazol-3-yl)sulfonylpiperazine.
| Compound Name | 2-methyl-1-(2-methylpyrazol-3-yl)sulfonylpiperazine |
|---|---|
| PubChem CID | 104710234 |
| Molecular Formula | C9H16N4O2S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2-methyl-1-(2-methylpyrazol-3-yl)sulfonylpiperazine |
| SMILES | CC1CNCCN1S(=O)(=O)c1ccnn1C |
| InChI | InChI=1S/C9H16N4O2S/c1-8-7-10-5-6-13(8)16(14,15)9-3-4-11-12(9)2/h3-4,8,10H,5-7H2,1-2H3 |
| InChIKey | KQFBBUDKTVYRML-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |