C18H16ClNO2SSe — CID 71652463
(3R,4R)-3-(4-chlorophenoxy)-1-phenyl-5-thia-9-selena-1-azaspiro[3.5]nonan-2-one (PubChem CID 71652463) has the molecular formula C18H16ClNO2SSe and a molecular weight of 424.81 g/mol. Its IUPAC name is (3R,4R)-3-(4-chlorophenoxy)-1-phenyl-5-thia-9-selena-1-azaspiro[3.5]nonan-2-one.
| Compound Name | (3R,4R)-3-(4-chlorophenoxy)-1-phenyl-5-thia-9-selena-1-azaspiro[3.5]nonan-2-one |
|---|---|
| PubChem CID | 71652463 |
| Molecular Formula | C18H16ClNO2SSe |
| Molecular Weight | 424.81 g/mol |
| Exact Mass | 424.98 |
| IUPAC Name | (3R,4R)-3-(4-chlorophenoxy)-1-phenyl-5-thia-9-selena-1-azaspiro[3.5]nonan-2-one |
| SMILES | O=C1[C@@H](Oc2ccc(Cl)cc2)[C@]2(SCCC[Se]2)N1c1ccccc1 |
| InChI | InChI=1S/C18H16ClNO2SSe/c19-13-7-9-15(10-8-13)22-16-17(21)20(14-5-2-1-3-6-14)18(16)23-11-4-12-24-18/h1-3,5-10,16H,4,11-12H2/t16-,18-/m1/s1 |
| InChIKey | RJLLRPKNKQBHOE-SJLPKXTDSA-N |
| XLogP | 4.05 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.81 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|