C19H14FNO4 — CID 71653137
(E)-N-[(4-fluorophenyl)methyl]-3-(7-hydroxy-4-oxochromen-3-yl)prop-2-enamide (PubChem CID 71653137) has the molecular formula C19H14FNO4 and a molecular weight of 339.32 g/mol. Its IUPAC name is (E)-N-[(4-fluorophenyl)methyl]-3-(7-hydroxy-4-oxochromen-3-yl)prop-2-enamide.
| Compound Name | (E)-N-[(4-fluorophenyl)methyl]-3-(7-hydroxy-4-oxochromen-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 71653137 |
| Molecular Formula | C19H14FNO4 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | (E)-N-[(4-fluorophenyl)methyl]-3-(7-hydroxy-4-oxochromen-3-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1coc2cc(O)ccc2c1=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H14FNO4/c20-14-4-1-12(2-5-14)10-21-18(23)8-3-13-11-25-17-9-15(22)6-7-16(17)19(13)24/h1-9,11,22H,10H2,(H,21,23)/b8-3+ |
| InChIKey | CPNJXUMJHWPBIX-FPYGCLRLSA-N |
| XLogP | 2.97 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|