C28H34O6 — CID 71653320
(E)-1-(2,2,8,8-tetramethyl-3,4,9,10-tetrahydropyrano[2,3-f]chromen-6-yl)-3-(2,4,6-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 71653320) has the molecular formula C28H34O6 and a molecular weight of 466.57 g/mol. Its IUPAC name is (E)-1-(2,2,8,8-tetramethyl-3,4,9,10-tetrahydropyrano[2,3-f]chromen-6-yl)-3-(2,4,6-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(2,2,8,8-tetramethyl-3,4,9,10-tetrahydropyrano[2,3-f]chromen-6-yl)-3-(2,4,6-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 71653320 |
| Molecular Formula | C28H34O6 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | (E)-1-(2,2,8,8-tetramethyl-3,4,9,10-tetrahydropyrano[2,3-f]chromen-6-yl)-3-(2,4,6-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(OC)c(/C=C/C(=O)c2cc3c(c4c2OC(C)(C)CC4)OC(C)(C)CC3)c(OC)c1 |
| InChI | InChI=1S/C28H34O6/c1-27(2)12-10-17-14-21(26-20(25(17)33-27)11-13-28(3,4)34-26)22(29)9-8-19-23(31-6)15-18(30-5)16-24(19)32-7/h8-9,14-16H,10-13H2,1-7H3/b9-8+ |
| InChIKey | FFFOUTMMTMIZIA-CMDGGOBGSA-N |
| XLogP | 5.82 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|