C15H14N4OS — CID 71655664
1-ethyl-3-(6-pyridin-4-yl-1,3-benzothiazol-2-yl)urea (PubChem CID 71655664) has the molecular formula C15H14N4OS and a molecular weight of 298.37 g/mol. Its IUPAC name is 1-ethyl-3-(6-pyridin-4-yl-1,3-benzothiazol-2-yl)urea.
| Compound Name | 1-ethyl-3-(6-pyridin-4-yl-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 71655664 |
| Molecular Formula | C15H14N4OS |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 1-ethyl-3-(6-pyridin-4-yl-1,3-benzothiazol-2-yl)urea |
| SMILES | CCNC(=O)Nc1nc2ccc(-c3ccncc3)cc2s1 |
| InChI | InChI=1S/C15H14N4OS/c1-2-17-14(20)19-15-18-12-4-3-11(9-13(12)21-15)10-5-7-16-8-6-10/h3-9H,2H2,1H3,(H2,17,18,19,20) |
| InChIKey | JEFLIOUUYGTZOU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |