C21H26N3O4S+ — CID 7165677
2-[2-(4-propylsulfonylpiperazin-1-ium-1-yl)ethyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 7165677) has the molecular formula C21H26N3O4S+ and a molecular weight of 416.52 g/mol. Its IUPAC name is 2-[2-(4-propylsulfonylpiperazin-1-ium-1-yl)ethyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[2-(4-propylsulfonylpiperazin-1-ium-1-yl)ethyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 7165677 |
| Molecular Formula | C21H26N3O4S+ |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 2-[2-(4-propylsulfonylpiperazin-1-ium-1-yl)ethyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | CCCS(=O)(=O)N1CC[NH+](CCN2C(=O)c3cccc4cccc(c34)C2=O)CC1 |
| InChI | InChI=1S/C21H25N3O4S/c1-2-15-29(27,28)23-12-9-22(10-13-23)11-14-24-20(25)17-7-3-5-16-6-4-8-18(19(16)17)21(24)26/h3-8H,2,9-15H2,1H3/p+1 |
| InChIKey | YAEDBKZSUPGGTE-UHFFFAOYSA-O |
| XLogP | 0.38 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|