C18H13ClF3N3O3S — CID 71657464
2-[[3-chloro-2-(hydrazinecarbonyl)-1-benzothiophen-6-yl]oxy]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 71657464) has the molecular formula C18H13ClF3N3O3S and a molecular weight of 443.83 g/mol. Its IUPAC name is 2-[[3-chloro-2-(hydrazinecarbonyl)-1-benzothiophen-6-yl]oxy]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[[3-chloro-2-(hydrazinecarbonyl)-1-benzothiophen-6-yl]oxy]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 71657464 |
| Molecular Formula | C18H13ClF3N3O3S |
| Molecular Weight | 443.83 g/mol |
| Exact Mass | 443.03 |
| IUPAC Name | 2-[[3-chloro-2-(hydrazinecarbonyl)-1-benzothiophen-6-yl]oxy]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | NNC(=O)c1sc2cc(OCC(=O)Nc3cccc(C(F)(F)F)c3)ccc2c1Cl |
| InChI | InChI=1S/C18H13ClF3N3O3S/c19-15-12-5-4-11(7-13(12)29-16(15)17(27)25-23)28-8-14(26)24-10-3-1-2-9(6-10)18(20,21)22/h1-7H,8,23H2,(H,24,26)(H,25,27) |
| InChIKey | YAPNRKHYPVIQIU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.83 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|