C30H33BrO5 — CID 71659032
1-(4-bromophenyl)-7-(3-methoxy-5-phenylmethoxy-4-propan-2-yloxyphenyl)heptane-3,5-dione (PubChem CID 71659032) has the molecular formula C30H33BrO5 and a molecular weight of 553.49 g/mol. Its IUPAC name is 1-(4-bromophenyl)-7-(3-methoxy-5-phenylmethoxy-4-propan-2-yloxyphenyl)heptane-3,5-dione.
| Compound Name | 1-(4-bromophenyl)-7-(3-methoxy-5-phenylmethoxy-4-propan-2-yloxyphenyl)heptane-3,5-dione |
|---|---|
| PubChem CID | 71659032 |
| Molecular Formula | C30H33BrO5 |
| Molecular Weight | 553.49 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | 1-(4-bromophenyl)-7-(3-methoxy-5-phenylmethoxy-4-propan-2-yloxyphenyl)heptane-3,5-dione |
| SMILES | COc1cc(CCC(=O)CC(=O)CCc2ccc(Br)cc2)cc(OCc2ccccc2)c1OC(C)C |
| InChI | InChI=1S/C30H33BrO5/c1-21(2)36-30-28(34-3)17-24(18-29(30)35-20-23-7-5-4-6-8-23)12-16-27(33)19-26(32)15-11-22-9-13-25(31)14-10-22/h4-10,13-14,17-18,21H,11-12,15-16,19-20H2,1-3H3 |
| InChIKey | XHFUUGODKDHTJO-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.49 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|