C24H29NO5 — CID 71660685
N,N-diethyl-6-formyl-2-(methoxymethoxy)-4-phenylmethoxy-3-[(E)-prop-1-enyl]benzamide (PubChem CID 71660685) has the molecular formula C24H29NO5 and a molecular weight of 411.50 g/mol. Its IUPAC name is N,N-diethyl-6-formyl-2-(methoxymethoxy)-4-phenylmethoxy-3-[(E)-prop-1-enyl]benzamide.
| Compound Name | N,N-diethyl-6-formyl-2-(methoxymethoxy)-4-phenylmethoxy-3-[(E)-prop-1-enyl]benzamide |
|---|---|
| PubChem CID | 71660685 |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | N,N-diethyl-6-formyl-2-(methoxymethoxy)-4-phenylmethoxy-3-[(E)-prop-1-enyl]benzamide |
| SMILES | C/C=C/c1c(OCc2ccccc2)cc(C=O)c(C(=O)N(CC)CC)c1OCOC |
| InChI | InChI=1S/C24H29NO5/c1-5-11-20-21(29-16-18-12-9-8-10-13-18)14-19(15-26)22(23(20)30-17-28-4)24(27)25(6-2)7-3/h5,8-15H,6-7,16-17H2,1-4H3/b11-5+ |
| InChIKey | IXUJOMMLJHWGKP-VZUCSPMQSA-N |
| XLogP | 4.58 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|