C22H32O3 — CID 71662031
(5E)-2-[(4-methoxyphenyl)methoxymethyl]-6,10-dimethylundeca-1,5,10-trien-4-ol (PubChem CID 71662031) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is (5E)-2-[(4-methoxyphenyl)methoxymethyl]-6,10-dimethylundeca-1,5,10-trien-4-ol.
| Compound Name | (5E)-2-[(4-methoxyphenyl)methoxymethyl]-6,10-dimethylundeca-1,5,10-trien-4-ol |
|---|---|
| PubChem CID | 71662031 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (5E)-2-[(4-methoxyphenyl)methoxymethyl]-6,10-dimethylundeca-1,5,10-trien-4-ol |
| SMILES | C=C(C)CCC/C(C)=C/C(O)CC(=C)COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H32O3/c1-17(2)7-6-8-18(3)13-21(23)14-19(4)15-25-16-20-9-11-22(24-5)12-10-20/h9-13,21,23H,1,4,6-8,14-16H2,2-3,5H3/b18-13+ |
| InChIKey | VMHGPIAHXOHEHZ-QGOAFFKASA-N |
| XLogP | 5.21 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|