C27H46O4Si2 — CID 71665234
methyl (4S,7E,9E,11R)-4,11-bis[[tert-butyl(dimethyl)silyl]oxy]tetradeca-7,9-dien-5,13-diynoate (PubChem CID 71665234) has the molecular formula C27H46O4Si2 and a molecular weight of 490.83 g/mol. Its IUPAC name is methyl (4S,7E,9E,11R)-4,11-bis[[tert-butyl(dimethyl)silyl]oxy]tetradeca-7,9-dien-5,13-diynoate.
| Compound Name | methyl (4S,7E,9E,11R)-4,11-bis[[tert-butyl(dimethyl)silyl]oxy]tetradeca-7,9-dien-5,13-diynoate |
|---|---|
| PubChem CID | 71665234 |
| Molecular Formula | C27H46O4Si2 |
| Molecular Weight | 490.83 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | methyl (4S,7E,9E,11R)-4,11-bis[[tert-butyl(dimethyl)silyl]oxy]tetradeca-7,9-dien-5,13-diynoate |
| SMILES | C#CC[C@H](/C=C/C=C/C#C[C@H](CCC(=O)OC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H46O4Si2/c1-13-18-23(30-32(9,10)26(2,3)4)19-16-14-15-17-20-24(21-22-25(28)29-8)31-33(11,12)27(5,6)7/h1,14-16,19,23-24H,18,21-22H2,2-12H3/b15-14+,19-16+/t23-,24-/m1/s1 |
| InChIKey | OJEGPHFCPBRNFI-OVVCDXPCSA-N |
| XLogP | 6.86 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.83 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|