C28H33N7O3 — CID 71667815
3-[4-[(3S)-3,4-dimethylpiperazin-1-yl]anilino]-6-ethyl-5-[3-(prop-2-enoylamino)phenoxy]pyrazine-2-carboxamide (PubChem CID 71667815) has the molecular formula C28H33N7O3 and a molecular weight of 515.62 g/mol. Its IUPAC name is 3-[4-[(3S)-3,4-dimethylpiperazin-1-yl]anilino]-6-ethyl-5-[3-(prop-2-enoylamino)phenoxy]pyrazine-2-carboxamide.
| Compound Name | 3-[4-[(3S)-3,4-dimethylpiperazin-1-yl]anilino]-6-ethyl-5-[3-(prop-2-enoylamino)phenoxy]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 71667815 |
| Molecular Formula | C28H33N7O3 |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | 3-[4-[(3S)-3,4-dimethylpiperazin-1-yl]anilino]-6-ethyl-5-[3-(prop-2-enoylamino)phenoxy]pyrazine-2-carboxamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(N4CCN(C)[C@@H](C)C4)cc3)c(C(N)=O)nc2CC)c1 |
| InChI | InChI=1S/C28H33N7O3/c1-5-23-28(38-22-9-7-8-20(16-22)30-24(36)6-2)33-27(25(32-23)26(29)37)31-19-10-12-21(13-11-19)35-15-14-34(4)18(3)17-35/h6-13,16,18H,2,5,14-15,17H2,1,3-4H3,(H2,29,37)(H,30,36)(H,31,33)/t18-/m0/s1 |
| InChIKey | VIKYVWOFKQNEHB-SFHVURJKSA-N |
| XLogP | 3.94 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|