C19H17NO7 — CID 71676552
trimethyl 12-cyano-10-hydroxytricyclo[6.3.1.02,7]dodeca-2,4,6,9-tetraene-9,11,12-tricarboxylate (PubChem CID 71676552) has the molecular formula C19H17NO7 and a molecular weight of 371.35 g/mol. Its IUPAC name is trimethyl 12-cyano-10-hydroxytricyclo[6.3.1.02,7]dodeca-2,4,6,9-tetraene-9,11,12-tricarboxylate.
| Compound Name | trimethyl 12-cyano-10-hydroxytricyclo[6.3.1.02,7]dodeca-2,4,6,9-tetraene-9,11,12-tricarboxylate |
|---|---|
| PubChem CID | 71676552 |
| Molecular Formula | C19H17NO7 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | trimethyl 12-cyano-10-hydroxytricyclo[6.3.1.02,7]dodeca-2,4,6,9-tetraene-9,11,12-tricarboxylate |
| SMILES | COC(=O)C1=C(O)C(C(=O)OC)C2c3ccccc3C1C2(C#N)C(=O)OC |
| InChI | InChI=1S/C19H17NO7/c1-25-16(22)11-13-9-6-4-5-7-10(9)14(12(15(11)21)17(23)26-2)19(13,8-20)18(24)27-3/h4-7,11,13-14,21H,1-3H3 |
| InChIKey | UBGCZCPWHWFJNO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 122.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|