C22H30ClN3O4S2 — CID 71680865
N-[(3S,4S)-1-(6-aminohexanoyl)-4-sulfanylpyrrolidin-3-yl]-4-phenoxybenzenesulfonamide;hydrochloride (PubChem CID 71680865) has the molecular formula C22H30ClN3O4S2 and a molecular weight of 500.09 g/mol. Its IUPAC name is N-[(3S,4S)-1-(6-aminohexanoyl)-4-sulfanylpyrrolidin-3-yl]-4-phenoxybenzenesulfonamide;hydrochloride.
| Compound Name | N-[(3S,4S)-1-(6-aminohexanoyl)-4-sulfanylpyrrolidin-3-yl]-4-phenoxybenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 71680865 |
| Molecular Formula | C22H30ClN3O4S2 |
| Molecular Weight | 500.09 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | N-[(3S,4S)-1-(6-aminohexanoyl)-4-sulfanylpyrrolidin-3-yl]-4-phenoxybenzenesulfonamide;hydrochloride |
| SMILES | Cl.NCCCCCC(=O)N1C[C@H](NS(=O)(=O)c2ccc(Oc3ccccc3)cc2)[C@@H](S)C1 |
| InChI | InChI=1S/C22H29N3O4S2.ClH/c23-14-6-2-5-9-22(26)25-15-20(21(30)16-25)24-31(27,28)19-12-10-18(11-13-19)29-17-7-3-1-4-8-17;/h1,3-4,7-8,10-13,20-21,24,30H,2,5-6,9,14-16,23H2;1H/t20-,21-;/m0./s1 |
| InChIKey | FHORSTUZHMJGTR-GUTACTQSSA-N |
| XLogP | 3.21 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.09 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|