C20H20N4O3S — CID 71681406
3-cyano-1-ethyl-2-[4-(ethylsulfonylamino)phenyl]indole-6-carboxamide (PubChem CID 71681406) has the molecular formula C20H20N4O3S and a molecular weight of 396.47 g/mol. Its IUPAC name is 3-cyano-1-ethyl-2-[4-(ethylsulfonylamino)phenyl]indole-6-carboxamide.
| Compound Name | 3-cyano-1-ethyl-2-[4-(ethylsulfonylamino)phenyl]indole-6-carboxamide |
|---|---|
| PubChem CID | 71681406 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 3-cyano-1-ethyl-2-[4-(ethylsulfonylamino)phenyl]indole-6-carboxamide |
| SMILES | CCn1c(-c2ccc(NS(=O)(=O)CC)cc2)c(C#N)c2ccc(C(N)=O)cc21 |
| InChI | InChI=1S/C20H20N4O3S/c1-3-24-18-11-14(20(22)25)7-10-16(18)17(12-21)19(24)13-5-8-15(9-6-13)23-28(26,27)4-2/h5-11,23H,3-4H2,1-2H3,(H2,22,25) |
| InChIKey | QJTKUOGUPMANHF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |