C26H48O5Si — CID 71681606
2-[(2S,4R,6S)-6-[[(2S,6R)-6-but-3-enyloxan-2-yl]methyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetic acid (PubChem CID 71681606) has the molecular formula C26H48O5Si and a molecular weight of 468.75 g/mol. Its IUPAC name is 2-[(2S,4R,6S)-6-[[(2S,6R)-6-but-3-enyloxan-2-yl]methyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetic acid.
| Compound Name | 2-[(2S,4R,6S)-6-[[(2S,6R)-6-but-3-enyloxan-2-yl]methyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 71681606 |
| Molecular Formula | C26H48O5Si |
| Molecular Weight | 468.75 g/mol |
| Exact Mass | 468.33 |
| IUPAC Name | 2-[(2S,4R,6S)-6-[[(2S,6R)-6-but-3-enyloxan-2-yl]methyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetic acid |
| SMILES | C=CCC[C@H]1CCC[C@@H](C[C@H]2C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)C[C@@H](CC(=O)O)O2)O1 |
| InChI | InChI=1S/C26H48O5Si/c1-8-9-11-21-12-10-13-22(29-21)14-23-15-25(16-24(30-23)17-26(27)28)31-32(18(2)3,19(4)5)20(6)7/h8,18-25H,1,9-17H2,2-7H3,(H,27,28)/t21-,22-,23-,24-,25+/m0/s1 |
| InChIKey | RZBLOPISZCXUEY-KFEALIJWSA-N |
| XLogP | 6.86 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.75 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|