C18H23FN2O6S — CID 71682311
1-[(3S)-3-fluoro-4-hydroxybutyl]-5-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]sulfonylindole-2,3-dione (PubChem CID 71682311) has the molecular formula C18H23FN2O6S and a molecular weight of 414.46 g/mol. Its IUPAC name is 1-[(3S)-3-fluoro-4-hydroxybutyl]-5-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]sulfonylindole-2,3-dione.
| Compound Name | 1-[(3S)-3-fluoro-4-hydroxybutyl]-5-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]sulfonylindole-2,3-dione |
|---|---|
| PubChem CID | 71682311 |
| Molecular Formula | C18H23FN2O6S |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 1-[(3S)-3-fluoro-4-hydroxybutyl]-5-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]sulfonylindole-2,3-dione |
| SMILES | COC[C@@H]1CCCN1S(=O)(=O)c1ccc2c(c1)C(=O)C(=O)N2CC[C@H](F)CO |
| InChI | InChI=1S/C18H23FN2O6S/c1-27-11-13-3-2-7-21(13)28(25,26)14-4-5-16-15(9-14)17(23)18(24)20(16)8-6-12(19)10-22/h4-5,9,12-13,22H,2-3,6-8,10-11H2,1H3/t12-,13-/m0/s1 |
| InChIKey | OEZQRTUGLYPVGI-STQMWFEESA-N |
| XLogP | 0.74 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|