C23H42O5Si — CID 71682856
[(1S,2R,5R,6R,7S,8R,10R)-7-hydroxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-10-yl] 2-[tert-butyl(dimethyl)silyl]oxyacetate (PubChem CID 71682856) has the molecular formula C23H42O5Si and a molecular weight of 426.67 g/mol. Its IUPAC name is [(1S,2R,5R,6R,7S,8R,10R)-7-hydroxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-10-yl] 2-[tert-butyl(dimethyl)silyl]oxyacetate.
| Compound Name | [(1S,2R,5R,6R,7S,8R,10R)-7-hydroxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-10-yl] 2-[tert-butyl(dimethyl)silyl]oxyacetate |
|---|---|
| PubChem CID | 71682856 |
| Molecular Formula | C23H42O5Si |
| Molecular Weight | 426.67 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | [(1S,2R,5R,6R,7S,8R,10R)-7-hydroxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-10-yl] 2-[tert-butyl(dimethyl)silyl]oxyacetate |
| SMILES | CC(C)[C@@]12C[C@@H](OC(=O)CO[Si](C)(C)C(C)(C)C)[C@@](C)(O1)[C@@H]1CC[C@@H](C)[C@H]1[C@@H]2O |
| InChI | InChI=1S/C23H42O5Si/c1-14(2)23-12-17(27-18(24)13-26-29(8,9)21(4,5)6)22(7,28-23)16-11-10-15(3)19(16)20(23)25/h14-17,19-20,25H,10-13H2,1-9H3/t15-,16-,17-,19-,20+,22+,23-/m1/s1 |
| InChIKey | XUCNLWPERCDVJY-ALHPSQGMSA-N |
| XLogP | 4.53 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.67 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|