C14H16N2O4S2 — CID 71690081
[4-(furan-2-yl)thiophen-2-yl]-(4-methylsulfonylpiperazin-1-yl)methanone (PubChem CID 71690081) has the molecular formula C14H16N2O4S2 and a molecular weight of 340.43 g/mol. Its IUPAC name is [4-(furan-2-yl)thiophen-2-yl]-(4-methylsulfonylpiperazin-1-yl)methanone.
| Compound Name | [4-(furan-2-yl)thiophen-2-yl]-(4-methylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 71690081 |
| Molecular Formula | C14H16N2O4S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | [4-(furan-2-yl)thiophen-2-yl]-(4-methylsulfonylpiperazin-1-yl)methanone |
| SMILES | CS(=O)(=O)N1CCN(C(=O)c2cc(-c3ccco3)cs2)CC1 |
| InChI | InChI=1S/C14H16N2O4S2/c1-22(18,19)16-6-4-15(5-7-16)14(17)13-9-11(10-21-13)12-3-2-8-20-12/h2-3,8-10H,4-7H2,1H3 |
| InChIKey | VPJBQHGYLKKKMB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |