C11H14N2O5S2 — CID 60721956
5-(4-methylsulfonylpiperazine-1-carbonyl)thiophene-2-carboxylic acid (PubChem CID 60721956) has the molecular formula C11H14N2O5S2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 5-(4-methylsulfonylpiperazine-1-carbonyl)thiophene-2-carboxylic acid.
| Compound Name | 5-(4-methylsulfonylpiperazine-1-carbonyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 60721956 |
| Molecular Formula | C11H14N2O5S2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 5-(4-methylsulfonylpiperazine-1-carbonyl)thiophene-2-carboxylic acid |
| SMILES | CS(=O)(=O)N1CCN(C(=O)c2ccc(C(=O)O)s2)CC1 |
| InChI | InChI=1S/C11H14N2O5S2/c1-20(17,18)13-6-4-12(5-7-13)10(14)8-2-3-9(19-8)11(15)16/h2-3H,4-7H2,1H3,(H,15,16) |
| InChIKey | NBDSOJNTDHRHFZ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |