About (2-ethylthieno[2,3-b]thiophen-5-yl)-(4-methylsulfonylpiperazin-1-yl)methanone
(2-ethylthieno[2,3-b]thiophen-5-yl)-(4-methylsulfonylpiperazin-1-yl)methanone (PubChem CID 91950453) has the molecular formula C14H18N2O3S3
and a molecular weight of 358.51 g/mol. Its IUPAC name is (2-ethylthieno[2,3-b]thiophen-5-yl)-(4-methylsulfonylpiperazin-1-yl)methanone.
Molecular Properties
| Compound Name | (2-ethylthieno[2,3-b]thiophen-5-yl)-(4-methylsulfonylpiperazin-1-yl)methanone |
| PubChem CID | 91950453 |
| Molecular Formula | C14H18N2O3S3 |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | (2-ethylthieno[2,3-b]thiophen-5-yl)-(4-methylsulfonylpiperazin-1-yl)methanone |
| SMILES | CCc1cc2cc(C(=O)N3CCN(S(C)(=O)=O)CC3)sc2s1 |
| InChI | InChI=1S/C14H18N2O3S3/c1-3-11-8-10-9-12(21-14(10)20-11)13(17)15-4-6-16(7-5-15)22(2,18)19/h8-9H,3-7H2,1-2H3 |
| InChIKey | DXJHSEATUPGNOX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-ethylthieno[2,3-b]thiophen-5-yl)-(4-methylsulfonylpiperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethylthieno[2,3-b]thiophen-5-yl)-(4-methylsulfonylpiperazin-1-yl)methanone?
The IUPAC name of (2-ethylthieno[2,3-b]thiophen-5-yl)-(4-methylsulfonylpiperazin-1-yl)methanone (CID 91950453) is (2-ethylthieno[2,3-b]thiophen-5-yl)-(4-methylsulfonylpiperazin-1-yl)methanone.
What is the SMILES notation for (2-ethylthieno[2,3-b]thiophen-5-yl)-(4-methylsulfonylpiperazin-1-yl)methanone?
The canonical SMILES for (2-ethylthieno[2,3-b]thiophen-5-yl)-(4-methylsulfonylpiperazin-1-yl)methanone is CCc1cc2cc(C(=O)N3CCN(S(C)(=O)=O)CC3)sc2s1.
What is the InChIKey of (2-ethylthieno[2,3-b]thiophen-5-yl)-(4-methylsulfonylpiperazin-1-yl)methanone?
The InChIKey is DXJHSEATUPGNOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O3S3/c1-3-11-8-10-9-12(21-14(10)20-11)13(17)15-4-6-16(7-5-15)22(2,18)19/h8-9H,3-7H2,1-2H3.
What are the key properties of (2-ethylthieno[2,3-b]thiophen-5-yl)-(4-methylsulfonylpiperazin-1-yl)methanone?
(2-ethylthieno[2,3-b]thiophen-5-yl)-(4-methylsulfonylpiperazin-1-yl)methanone has a molecular weight of 358.51 g/mol, XLogP of 2.24, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethylthieno[2,3-b]thiophen-5-yl)-(4-methylsulfonylpiperazin-1-yl)methanone is sourced from PubChem (CID 91950453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).