C21H14F3N5O — CID 71694646
2-(4-pyridin-4-ylpyrazol-1-yl)-N-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide (PubChem CID 71694646) has the molecular formula C21H14F3N5O and a molecular weight of 409.37 g/mol. Its IUPAC name is 2-(4-pyridin-4-ylpyrazol-1-yl)-N-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide.
| Compound Name | 2-(4-pyridin-4-ylpyrazol-1-yl)-N-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 71694646 |
| Molecular Formula | C21H14F3N5O |
| Molecular Weight | 409.37 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 2-(4-pyridin-4-ylpyrazol-1-yl)-N-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1cccnc1-n1cc(-c2ccncc2)cn1 |
| InChI | InChI=1S/C21H14F3N5O/c22-21(23,24)16-3-1-4-17(11-16)28-20(30)18-5-2-8-26-19(18)29-13-15(12-27-29)14-6-9-25-10-7-14/h1-13H,(H,28,30) |
| InChIKey | UYRLVVLKHRRZJN-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.37 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |