C24H19F3N4O3 — CID 68819781
2-[[2-(2,5-dioxopyrrolidin-1-yl)-3-pyridinyl]methylamino]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 68819781) has the molecular formula C24H19F3N4O3 and a molecular weight of 468.44 g/mol. Its IUPAC name is 2-[[2-(2,5-dioxopyrrolidin-1-yl)-3-pyridinyl]methylamino]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2-[[2-(2,5-dioxopyrrolidin-1-yl)-3-pyridinyl]methylamino]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 68819781 |
| Molecular Formula | C24H19F3N4O3 |
| Molecular Weight | 468.44 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 2-[[2-(2,5-dioxopyrrolidin-1-yl)-3-pyridinyl]methylamino]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1ccccc1NCc1cccnc1N1C(=O)CCC1=O |
| InChI | InChI=1S/C24H19F3N4O3/c25-24(26,27)16-6-3-7-17(13-16)30-23(34)18-8-1-2-9-19(18)29-14-15-5-4-12-28-22(15)31-20(32)10-11-21(31)33/h1-9,12-13,29H,10-11,14H2,(H,30,34) |
| InChIKey | AWNPVZDAFLSKAA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|