C35H34BF2N3O3 — CID 71696908
2,2-difluoro-11-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-4,6,8,10,12-pentamethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaene-5-carbaldehyde (PubChem CID 71696908) has the molecular formula C35H34BF2N3O3 and a molecular weight of 593.48 g/mol. Its IUPAC name is 2,2-difluoro-11-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-4,6,8,10,12-pentamethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaene-5-carbaldehyde.
| Compound Name | 2,2-difluoro-11-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-4,6,8,10,12-pentamethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaene-5-carbaldehyde |
|---|---|
| PubChem CID | 71696908 |
| Molecular Formula | C35H34BF2N3O3 |
| Molecular Weight | 593.48 g/mol |
| Exact Mass | 593.27 |
| IUPAC Name | 2,2-difluoro-11-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-4,6,8,10,12-pentamethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaene-5-carbaldehyde |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc(-c3c(C)c4n(c3C)[B-](F)(F)[N+]3=C(C)C(C=O)=C(C)C3=C4C)cc2)cc1 |
| InChI | InChI=1S/C35H34BF2N3O3/c1-21-32(20-42)24(4)40-34(21)23(3)35-22(2)33(25(5)41(35)36(40,37)38)26-8-10-27(11-9-26)39(28-12-16-30(43-6)17-13-28)29-14-18-31(44-7)19-15-29/h8-20H,1-7H3 |
| InChIKey | GDNAIGYGOPHDOH-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 46.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.48 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|