C45H54BF2N3O3 — CID 71696990
2,2-difluoro-11-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-4,6,8,10,12-pentamethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaene-5-carbaldehyde (PubChem CID 71696990) has the molecular formula C45H54BF2N3O3 and a molecular weight of 733.75 g/mol. Its IUPAC name is 2,2-difluoro-11-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-4,6,8,10,12-pentamethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaene-5-carbaldehyde.
| Compound Name | 2,2-difluoro-11-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-4,6,8,10,12-pentamethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaene-5-carbaldehyde |
|---|---|
| PubChem CID | 71696990 |
| Molecular Formula | C45H54BF2N3O3 |
| Molecular Weight | 733.75 g/mol |
| Exact Mass | 733.42 |
| IUPAC Name | 2,2-difluoro-11-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-4,6,8,10,12-pentamethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaene-5-carbaldehyde |
| SMILES | CCCCCCOc1ccc(N(c2ccc(OCCCCCC)cc2)c2ccc(-c3c(C)c4n(c3C)[B-](F)(F)[N+]3=C(C)C(C=O)=C(C)C3=C4C)cc2)cc1 |
| InChI | InChI=1S/C45H54BF2N3O3/c1-8-10-12-14-28-53-40-24-20-38(21-25-40)49(39-22-26-41(27-23-39)54-29-15-13-11-9-2)37-18-16-36(17-19-37)43-32(4)45-33(5)44-31(3)42(30-52)34(6)50(44)46(47,48)51(45)35(43)7/h16-27,30H,8-15,28-29H2,1-7H3 |
| InChIKey | ACMKKDCQJOIISA-UHFFFAOYSA-N |
| XLogP | 12.13 |
| TPSA | 46.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.75 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|