C43H35BFN2O+ — CID 176876678
8-(4-butoxyphenyl)-2-fluoro-4,6,10,12-tetraphenyl-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 176876678) has the molecular formula C43H35BFN2O+ and a molecular weight of 625.58 g/mol. Its IUPAC name is 8-(4-butoxyphenyl)-2-fluoro-4,6,10,12-tetraphenyl-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 8-(4-butoxyphenyl)-2-fluoro-4,6,10,12-tetraphenyl-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 176876678 |
| Molecular Formula | C43H35BFN2O+ |
| Molecular Weight | 625.58 g/mol |
| Exact Mass | 625.28 |
| IUPAC Name | 8-(4-butoxyphenyl)-2-fluoro-4,6,10,12-tetraphenyl-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | CCCCOc1ccc(C2=C3C(c4ccccc4)=CC(c4ccccc4)=[N+]3B(F)n3c(-c4ccccc4)cc(-c4ccccc4)c32)cc1 |
| InChI | InChI=1S/C43H35BFN2O/c1-2-3-28-48-36-26-24-35(25-27-36)41-42-37(31-16-8-4-9-17-31)29-39(33-20-12-6-13-21-33)46(42)44(45)47-40(34-22-14-7-15-23-34)30-38(43(41)47)32-18-10-5-11-19-32/h4-27,29-30H,2-3,28H2,1H3/q+1 |
| InChIKey | FJOLJLHZYHBGSA-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 17.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.58 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|