C23H19FO2S — CID 71697141
1-[(1E,3E)-4-(benzenesulfonyl)-4-fluoro-3-phenylbuta-1,3-dienyl]-4-methylbenzene (PubChem CID 71697141) has the molecular formula C23H19FO2S and a molecular weight of 378.47 g/mol. Its IUPAC name is 1-[(1E,3E)-4-(benzenesulfonyl)-4-fluoro-3-phenylbuta-1,3-dienyl]-4-methylbenzene.
| Compound Name | 1-[(1E,3E)-4-(benzenesulfonyl)-4-fluoro-3-phenylbuta-1,3-dienyl]-4-methylbenzene |
|---|---|
| PubChem CID | 71697141 |
| Molecular Formula | C23H19FO2S |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 1-[(1E,3E)-4-(benzenesulfonyl)-4-fluoro-3-phenylbuta-1,3-dienyl]-4-methylbenzene |
| SMILES | Cc1ccc(/C=C/C(=C(/F)S(=O)(=O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H19FO2S/c1-18-12-14-19(15-13-18)16-17-22(20-8-4-2-5-9-20)23(24)27(25,26)21-10-6-3-7-11-21/h2-17H,1H3/b17-16+,23-22+ |
| InChIKey | HZMNMEQDHURYIK-TVCFOCLESA-N |
| XLogP | 5.82 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|