C18H21N5O4 — CID 71698499
1-[5-[(2-methyl-5-nitroimidazol-1-yl)methyl]-2-(4-propan-2-ylphenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone (PubChem CID 71698499) has the molecular formula C18H21N5O4 and a molecular weight of 371.40 g/mol. Its IUPAC name is 1-[5-[(2-methyl-5-nitroimidazol-1-yl)methyl]-2-(4-propan-2-ylphenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone.
| Compound Name | 1-[5-[(2-methyl-5-nitroimidazol-1-yl)methyl]-2-(4-propan-2-ylphenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone |
|---|---|
| PubChem CID | 71698499 |
| Molecular Formula | C18H21N5O4 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 1-[5-[(2-methyl-5-nitroimidazol-1-yl)methyl]-2-(4-propan-2-ylphenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone |
| SMILES | CC(=O)N1N=C(Cn2c([N+](=O)[O-])cnc2C)OC1c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C18H21N5O4/c1-11(2)14-5-7-15(8-6-14)18-22(13(4)24)20-16(27-18)10-21-12(3)19-9-17(21)23(25)26/h5-9,11,18H,10H2,1-4H3 |
| InChIKey | GKRGXVZCZMSLCI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 102.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|