C23H25N3O5 — CID 122189421
2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-[(4-propan-2-ylphenyl)methoxy]benzoate (PubChem CID 122189421) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-[(4-propan-2-ylphenyl)methoxy]benzoate.
| Compound Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-[(4-propan-2-ylphenyl)methoxy]benzoate |
|---|---|
| PubChem CID | 122189421 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-[(4-propan-2-ylphenyl)methoxy]benzoate |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCOC(=O)c1ccccc1OCc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C23H25N3O5/c1-16(2)19-10-8-18(9-11-19)15-31-21-7-5-4-6-20(21)23(27)30-13-12-25-17(3)24-14-22(25)26(28)29/h4-11,14,16H,12-13,15H2,1-3H3 |
| InChIKey | WHPKOHPIQZJUFE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 96.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|