C24H24N2O3 — CID 71703081
7-methyl-4-[7-methyl-4-(piperidin-1-ylmethyl)furo[2,3-c]pyridin-2-yl]chromen-2-one (PubChem CID 71703081) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is 7-methyl-4-[7-methyl-4-(piperidin-1-ylmethyl)furo[2,3-c]pyridin-2-yl]chromen-2-one.
| Compound Name | 7-methyl-4-[7-methyl-4-(piperidin-1-ylmethyl)furo[2,3-c]pyridin-2-yl]chromen-2-one |
|---|---|
| PubChem CID | 71703081 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 7-methyl-4-[7-methyl-4-(piperidin-1-ylmethyl)furo[2,3-c]pyridin-2-yl]chromen-2-one |
| SMILES | Cc1ccc2c(-c3cc4c(CN5CCCCC5)cnc(C)c4o3)cc(=O)oc2c1 |
| InChI | InChI=1S/C24H24N2O3/c1-15-6-7-18-20(12-23(27)28-21(18)10-15)22-11-19-17(13-25-16(2)24(19)29-22)14-26-8-4-3-5-9-26/h6-7,10-13H,3-5,8-9,14H2,1-2H3 |
| InChIKey | PSZLCYFJPYGSJI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 59.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|