C24H24N2O4 — CID 71705186
6,7-dimethyl-4-[7-methyl-4-(morpholin-4-ylmethyl)furo[2,3-c]pyridin-2-yl]chromen-2-one (PubChem CID 71705186) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is 6,7-dimethyl-4-[7-methyl-4-(morpholin-4-ylmethyl)furo[2,3-c]pyridin-2-yl]chromen-2-one.
| Compound Name | 6,7-dimethyl-4-[7-methyl-4-(morpholin-4-ylmethyl)furo[2,3-c]pyridin-2-yl]chromen-2-one |
|---|---|
| PubChem CID | 71705186 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 6,7-dimethyl-4-[7-methyl-4-(morpholin-4-ylmethyl)furo[2,3-c]pyridin-2-yl]chromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(-c3cc4c(CN5CCOCC5)cnc(C)c4o3)c2cc1C |
| InChI | InChI=1S/C24H24N2O4/c1-14-8-19-20(11-23(27)29-21(19)9-15(14)2)22-10-18-17(12-25-16(3)24(18)30-22)13-26-4-6-28-7-5-26/h8-12H,4-7,13H2,1-3H3 |
| InChIKey | GRHUERYKPKACSX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 68.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|