C26H28N2O3 — CID 71709741
4-[4-(azepan-1-ylmethyl)-7-methylfuro[2,3-c]pyridin-2-yl]-6,7-dimethylchromen-2-one (PubChem CID 71709741) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is 4-[4-(azepan-1-ylmethyl)-7-methylfuro[2,3-c]pyridin-2-yl]-6,7-dimethylchromen-2-one.
| Compound Name | 4-[4-(azepan-1-ylmethyl)-7-methylfuro[2,3-c]pyridin-2-yl]-6,7-dimethylchromen-2-one |
|---|---|
| PubChem CID | 71709741 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 4-[4-(azepan-1-ylmethyl)-7-methylfuro[2,3-c]pyridin-2-yl]-6,7-dimethylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(-c3cc4c(CN5CCCCCC5)cnc(C)c4o3)c2cc1C |
| InChI | InChI=1S/C26H28N2O3/c1-16-10-21-22(13-25(29)30-23(21)11-17(16)2)24-12-20-19(14-27-18(3)26(20)31-24)15-28-8-6-4-5-7-9-28/h10-14H,4-9,15H2,1-3H3 |
| InChIKey | ZCPDLONOGCANMK-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 59.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|