C29H28N4O3 — CID 71705009
7-methyl-4-[7-methyl-4-[[4-(pyridin-3-ylmethyl)piperazin-1-yl]methyl]furo[2,3-c]pyridin-2-yl]chromen-2-one (PubChem CID 71705009) has the molecular formula C29H28N4O3 and a molecular weight of 480.57 g/mol. Its IUPAC name is 7-methyl-4-[7-methyl-4-[[4-(pyridin-3-ylmethyl)piperazin-1-yl]methyl]furo[2,3-c]pyridin-2-yl]chromen-2-one.
| Compound Name | 7-methyl-4-[7-methyl-4-[[4-(pyridin-3-ylmethyl)piperazin-1-yl]methyl]furo[2,3-c]pyridin-2-yl]chromen-2-one |
|---|---|
| PubChem CID | 71705009 |
| Molecular Formula | C29H28N4O3 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 7-methyl-4-[7-methyl-4-[[4-(pyridin-3-ylmethyl)piperazin-1-yl]methyl]furo[2,3-c]pyridin-2-yl]chromen-2-one |
| SMILES | Cc1ccc2c(-c3cc4c(CN5CCN(Cc6cccnc6)CC5)cnc(C)c4o3)cc(=O)oc2c1 |
| InChI | InChI=1S/C29H28N4O3/c1-19-5-6-23-25(14-28(34)35-26(23)12-19)27-13-24-22(16-31-20(2)29(24)36-27)18-33-10-8-32(9-11-33)17-21-4-3-7-30-15-21/h3-7,12-16H,8-11,17-18H2,1-2H3 |
| InChIKey | XGKIEWYKZKQGLK-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 75.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|