C12H12N4 — CID 71713002
4-(2-aminoethylamino)quinoline-7-carbonitrile (PubChem CID 71713002) has the molecular formula C12H12N4 and a molecular weight of 212.26 g/mol. Its IUPAC name is 4-(2-aminoethylamino)quinoline-7-carbonitrile.
| Compound Name | 4-(2-aminoethylamino)quinoline-7-carbonitrile |
|---|---|
| PubChem CID | 71713002 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 4-(2-aminoethylamino)quinoline-7-carbonitrile |
| SMILES | N#Cc1ccc2c(NCCN)ccnc2c1 |
| InChI | InChI=1S/C12H12N4/c13-4-6-16-11-3-5-15-12-7-9(8-14)1-2-10(11)12/h1-3,5,7H,4,6,13H2,(H,15,16) |
| InChIKey | JKNFOPFXFUBVSS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |