6-silaspiro[5.5]undecan-3-ylazanium chloride

C10H22ClNSi — CID 71717301

IUPAC6-silaspiro[5.5]undecan-3-ylazanium chloride
SMILES[Cl-].[NH3+]C1CC[Si]2(CCCCC2)CC1
InChIInChI=1S/C10H21NSi.ClH/c11-10-4-8-12(9-5-10)6-2-1-3-7-12;/h10H,1-9,11H2;1H
InChIKeyHITXLQUWFZRJAZ-UHFFFAOYSA-N
MW219.83 g/mol
LogP-0.97
Rot. Bonds

About 6-silaspiro[5.5]undecan-3-ylazanium chloride

6-silaspiro[5.5]undecan-3-ylazanium chloride (PubChem CID 71717301) has the molecular formula C10H22ClNSi and a molecular weight of 219.83 g/mol. Its IUPAC name is 6-silaspiro[5.5]undecan-3-ylazanium chloride.

Molecular Properties

Compound Name6-silaspiro[5.5]undecan-3-ylazanium chloride
PubChem CID71717301
Molecular FormulaC10H22ClNSi
Molecular Weight219.83 g/mol
Exact Mass219.12
IUPAC Name6-silaspiro[5.5]undecan-3-ylazanium chloride
SMILES[Cl-].[NH3+]C1CC[Si]2(CCCCC2)CC1
InChIInChI=1S/C10H21NSi.ClH/c11-10-4-8-12(9-5-10)6-2-1-3-7-12;/h10H,1-9,11H2;1H
InChIKeyHITXLQUWFZRJAZ-UHFFFAOYSA-N
XLogP-0.97
TPSA27.64 Ų
H-Bond Donors1
H-Bond Acceptors
Rotatable Bonds
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.83
LogP ≤ 5-0.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze 6-silaspiro[5.5]undecan-3-ylazanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-silaspiro[5.5]undecan-3-ylazanium chloride?
The IUPAC name of 6-silaspiro[5.5]undecan-3-ylazanium chloride (CID 71717301) is 6-silaspiro[5.5]undecan-3-ylazanium chloride.
What is the SMILES notation for 6-silaspiro[5.5]undecan-3-ylazanium chloride?
The canonical SMILES for 6-silaspiro[5.5]undecan-3-ylazanium chloride is [Cl-].[NH3+]C1CC[Si]2(CCCCC2)CC1.
What is the InChIKey of 6-silaspiro[5.5]undecan-3-ylazanium chloride?
The InChIKey is HITXLQUWFZRJAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NSi.ClH/c11-10-4-8-12(9-5-10)6-2-1-3-7-12;/h10H,1-9,11H2;1H.
What are the key properties of 6-silaspiro[5.5]undecan-3-ylazanium chloride?
6-silaspiro[5.5]undecan-3-ylazanium chloride has a molecular weight of 219.83 g/mol, XLogP of -0.97, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-silaspiro[5.5]undecan-3-ylazanium chloride is sourced from PubChem (CID 71717301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).