C15H19N7O2 — CID 71717351
2-[9-propan-2-yl-6-(pyrimidin-5-ylamino)purin-8-yl]propane-1,3-diol (PubChem CID 71717351) has the molecular formula C15H19N7O2 and a molecular weight of 329.36 g/mol. Its IUPAC name is 2-[9-propan-2-yl-6-(pyrimidin-5-ylamino)purin-8-yl]propane-1,3-diol.
| Compound Name | 2-[9-propan-2-yl-6-(pyrimidin-5-ylamino)purin-8-yl]propane-1,3-diol |
|---|---|
| PubChem CID | 71717351 |
| Molecular Formula | C15H19N7O2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 2-[9-propan-2-yl-6-(pyrimidin-5-ylamino)purin-8-yl]propane-1,3-diol |
| SMILES | CC(C)n1c(C(CO)CO)nc2c(Nc3cncnc3)ncnc21 |
| InChI | InChI=1S/C15H19N7O2/c1-9(2)22-14(10(5-23)6-24)21-12-13(18-8-19-15(12)22)20-11-3-16-7-17-4-11/h3-4,7-10,23-24H,5-6H2,1-2H3,(H,18,19,20) |
| InChIKey | SQVRWWDOKKXDNA-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 121.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |